![(5-fluorofuro[2,3-b]pyridin-2-yl)methanol (CAS: 1186310-91-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0704951.png "(5-fluorofuro[2,3-b]pyridin-2-yl)methanol chemical structure")
(5-fluorofuro[2,3-b]pyridin-2-yl)methanol
Catalog No: FT-0704951
CAS No: 1186310-91-7
- Chemical Name: (5-fluorofuro[2,3-b]pyridin-2-yl)methanol
- Molecular Formula: C8H6FNO2
- Molecular Weight: 167.14
- InChI Key: BTLVIXKYMXGFPM-UHFFFAOYSA-N
- InChI: InChI=1S/C8H6FNO2/c9-6-1-5-2-7(4-11)12-8(5)10-3-6/h1-3,11H,4H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 1186310-91-7 |
|---|---|
| MF: | C8H6FNO2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | (5-Fluorofuro[2,3-b]pyridin-2-yl)methanol |
| Symbol: | GHS05 |
| Bolling_Point: | N/A |
| FW: | 167.13700 |
| Exact_Mass: | 167.03800 |
|---|---|
| MF: | C8H6FNO2 |
| LogP: | 1.45920 |
| PSA: | 46.26000 |
| FW: | 167.13700 |
| Symbol: | GHS05 |
|---|---|
| Safety_Statements: | H318 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P280-P305 + P351 + P338 |
